C7H13ClN4O3S — CID 106956708
N-[2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethyl]methanesulfonamide (PubChem CID 106956708) has the molecular formula C7H13ClN4O3S and a molecular weight of 268.73 g/mol. Its IUPAC name is N-[2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 106956708 |
| Molecular Formula | C7H13ClN4O3S |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | N-[2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1nnc(CCCl)o1 |
| InChI | InChI=1S/C7H13ClN4O3S/c1-16(13,14)10-5-4-9-7-12-11-6(15-7)2-3-8/h10H,2-5H2,1H3,(H,9,12) |
| InChIKey | MRORREWNDUWJQN-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|