C10H18ClN3O2 — CID 106958290
5-(2-chloroethyl)-N-(3-propoxypropyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106958290) has the molecular formula C10H18ClN3O2 and a molecular weight of 247.73 g/mol. Its IUPAC name is 5-(2-chloroethyl)-N-(3-propoxypropyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-chloroethyl)-N-(3-propoxypropyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106958290 |
| Molecular Formula | C10H18ClN3O2 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 5-(2-chloroethyl)-N-(3-propoxypropyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCOCCCNc1nnc(CCCl)o1 |
| InChI | InChI=1S/C10H18ClN3O2/c1-2-7-15-8-3-6-12-10-14-13-9(16-10)4-5-11/h2-8H2,1H3,(H,12,14) |
| InChIKey | BMWCYQDUKPLUBO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|