C7H11ClN4O3 — CID 106958370
2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethyl carbamate (PubChem CID 106958370) has the molecular formula C7H11ClN4O3 and a molecular weight of 234.64 g/mol. Its IUPAC name is 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethyl carbamate.
| Compound Name | 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 106958370 |
| Molecular Formula | C7H11ClN4O3 |
| Molecular Weight | 234.64 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1nnc(CCCl)o1 |
| InChI | InChI=1S/C7H11ClN4O3/c8-2-1-5-11-12-7(15-5)10-3-4-14-6(9)13/h1-4H2,(H2,9,13)(H,10,12) |
| InChIKey | SEIQBRFQSHNFTE-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.64 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|