C9H17N5O3 — CID 106964003
2-[[5-[1-(ethylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]ethyl carbamate (PubChem CID 106964003) has the molecular formula C9H17N5O3 and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-[[5-[1-(ethylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]ethyl carbamate.
| Compound Name | 2-[[5-[1-(ethylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 106964003 |
| Molecular Formula | C9H17N5O3 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2-[[5-[1-(ethylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]ethyl carbamate |
| SMILES | CCNC(C)c1nnc(NCCOC(N)=O)o1 |
| InChI | InChI=1S/C9H17N5O3/c1-3-11-6(2)7-13-14-9(17-7)12-4-5-16-8(10)15/h6,11H,3-5H2,1-2H3,(H2,10,15)(H,12,14) |
| InChIKey | CIWGYJTZTDMPHK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|