C11H22N6O2 — CID 106964060
3-[2-[[5-[1-(ethylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]-1,1-dimethylurea (PubChem CID 106964060) has the molecular formula C11H22N6O2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 3-[2-[[5-[1-(ethylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[[5-[1-(ethylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 106964060 |
| Molecular Formula | C11H22N6O2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 3-[2-[[5-[1-(ethylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]-1,1-dimethylurea |
| SMILES | CCNC(C)c1nnc(NCCNC(=O)N(C)C)o1 |
| InChI | InChI=1S/C11H22N6O2/c1-5-12-8(2)9-15-16-10(19-9)13-6-7-14-11(18)17(3)4/h8,12H,5-7H2,1-4H3,(H,13,16)(H,14,18) |
| InChIKey | KTBVRDMTDLHOIW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|