C7H12ClN3O — CID 106956296
5-(2-chloroethyl)-N-propyl-1,3,4-oxadiazol-2-amine (PubChem CID 106956296) has the molecular formula C7H12ClN3O and a molecular weight of 189.65 g/mol. Its IUPAC name is 5-(2-chloroethyl)-N-propyl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-chloroethyl)-N-propyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106956296 |
| Molecular Formula | C7H12ClN3O |
| Molecular Weight | 189.65 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 5-(2-chloroethyl)-N-propyl-1,3,4-oxadiazol-2-amine |
| SMILES | CCCNc1nnc(CCCl)o1 |
| InChI | InChI=1S/C7H12ClN3O/c1-2-5-9-7-11-10-6(12-7)3-4-8/h2-5H2,1H3,(H,9,11) |
| InChIKey | FOSFTBPMWQHVPB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.65 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|