C8H10ClN5O2 — CID 106413122
5-(2-chloroethyl)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106413122) has the molecular formula C8H10ClN5O2 and a molecular weight of 243.65 g/mol. Its IUPAC name is 5-(2-chloroethyl)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-chloroethyl)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106413122 |
| Molecular Formula | C8H10ClN5O2 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 5-(2-chloroethyl)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3,4-oxadiazol-2-amine |
| SMILES | ClCCc1nnc(NCCc2ncno2)o1 |
| InChI | InChI=1S/C8H10ClN5O2/c9-3-1-7-13-14-8(15-7)10-4-2-6-11-5-12-16-6/h5H,1-4H2,(H,10,14) |
| InChIKey | YJGBJADBJCEVSB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|