C7H12ClN3O2 — CID 106956546
5-(chloromethyl)-N-(3-methoxypropyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106956546) has the molecular formula C7H12ClN3O2 and a molecular weight of 205.64 g/mol. Its IUPAC name is 5-(chloromethyl)-N-(3-methoxypropyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(chloromethyl)-N-(3-methoxypropyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106956546 |
| Molecular Formula | C7H12ClN3O2 |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 5-(chloromethyl)-N-(3-methoxypropyl)-1,3,4-oxadiazol-2-amine |
| SMILES | COCCCNc1nnc(CCl)o1 |
| InChI | InChI=1S/C7H12ClN3O2/c1-12-4-2-3-9-7-11-10-6(5-8)13-7/h2-5H2,1H3,(H,9,11) |
| InChIKey | FHWZSXNPYZOKHM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|