C9H19N5O4S — CID 106969158
N-[2-[[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]methanesulfonamide (PubChem CID 106969158) has the molecular formula C9H19N5O4S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-[2-[[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 106969158 |
| Molecular Formula | C9H19N5O4S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[2-[[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]methanesulfonamide |
| SMILES | COCCNCc1nnc(NCCNS(C)(=O)=O)o1 |
| InChI | InChI=1S/C9H19N5O4S/c1-17-6-5-10-7-8-13-14-9(18-8)11-3-4-12-19(2,15)16/h10,12H,3-7H2,1-2H3,(H,11,14) |
| InChIKey | SPDDFTBEOWEJCW-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|