C7H15N5O3S — CID 106332569
N-[3-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]amino]propyl]methanesulfonamide (PubChem CID 106332569) has the molecular formula C7H15N5O3S and a molecular weight of 249.30 g/mol. Its IUPAC name is N-[3-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106332569 |
| Molecular Formula | C7H15N5O3S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-[3-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]amino]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNc1nnc(CN)o1 |
| InChI | InChI=1S/C7H15N5O3S/c1-16(13,14)10-4-2-3-9-7-12-11-6(5-8)15-7/h10H,2-5,8H2,1H3,(H,9,12) |
| InChIKey | WXRKAERGJBOIHN-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|