C10H8BrCl2N3O — CID 106956559
N-(4-bromo-2-chlorophenyl)-5-(2-chloroethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106956559) has the molecular formula C10H8BrCl2N3O and a molecular weight of 337.00 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-5-(2-chloroethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(4-bromo-2-chlorophenyl)-5-(2-chloroethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106956559 |
| Molecular Formula | C10H8BrCl2N3O |
| Molecular Weight | 337.00 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-5-(2-chloroethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | ClCCc1nnc(Nc2ccc(Br)cc2Cl)o1 |
| InChI | InChI=1S/C10H8BrCl2N3O/c11-6-1-2-8(7(13)5-6)14-10-16-15-9(17-10)3-4-12/h1-2,5H,3-4H2,(H,14,16) |
| InChIKey | LHFXQHBACBBMGY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.00 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|