C12H13BrClN3O — CID 107581526
N-(4-bromo-3,5-dimethylphenyl)-5-(2-chloroethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 107581526) has the molecular formula C12H13BrClN3O and a molecular weight of 330.61 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-5-(2-chloroethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-5-(2-chloroethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 107581526 |
| Molecular Formula | C12H13BrClN3O |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-5-(2-chloroethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Cc1cc(Nc2nnc(CCCl)o2)cc(C)c1Br |
| InChI | InChI=1S/C12H13BrClN3O/c1-7-5-9(6-8(2)11(7)13)15-12-17-16-10(18-12)3-4-14/h5-6H,3-4H2,1-2H3,(H,15,17) |
| InChIKey | TUSRMIZLKCECJA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|