C12H17ClN4O2S — CID 106046898
N-[2-(5-chlorothiophen-2-yl)ethyl]-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106046898) has the molecular formula C12H17ClN4O2S and a molecular weight of 316.81 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106046898 |
| Molecular Formula | C12H17ClN4O2S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine |
| SMILES | COCCNCc1nnc(NCCc2ccc(Cl)s2)o1 |
| InChI | InChI=1S/C12H17ClN4O2S/c1-18-7-6-14-8-11-16-17-12(19-11)15-5-4-9-2-3-10(13)20-9/h2-3,14H,4-8H2,1H3,(H,15,17) |
| InChIKey | VAZFXEIJZCOXEM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|