C9H15N3O — CID 28780022
5-(cyclohexylmethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 28780022) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(cyclohexylmethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 28780022 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 5-(cyclohexylmethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(CC2CCCCC2)o1 |
| InChI | InChI=1S/C9H15N3O/c10-9-12-11-8(13-9)6-7-4-2-1-3-5-7/h7H,1-6H2,(H2,10,12) |
| InChIKey | PIOZWIHCOPGZAV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |