About ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate
ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 112619354) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate.
Analyze ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate (CID 112619354) is ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate is CCOC(=O)c1nnc(CC2CCCCC2)o1.
What is the InChIKey of ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is WPVQOYNNRMNZJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-2-16-12(15)11-14-13-10(17-11)8-9-6-4-3-5-7-9/h9H,2-8H2,1H3.
What are the key properties of ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate?
ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 238.29 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(cyclohexylmethyl)-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 112619354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).