C7H10ClN3O3 — CID 118374926
ethyl 5-[2-(chloroamino)ethyl]-1,3,4-oxadiazole-2-carboxylate (PubChem CID 118374926) has the molecular formula C7H10ClN3O3 and a molecular weight of 219.63 g/mol. Its IUPAC name is ethyl 5-[2-(chloroamino)ethyl]-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | ethyl 5-[2-(chloroamino)ethyl]-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 118374926 |
| Molecular Formula | C7H10ClN3O3 |
| Molecular Weight | 219.63 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | ethyl 5-[2-(chloroamino)ethyl]-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(CCNCl)o1 |
| InChI | InChI=1S/C7H10ClN3O3/c1-2-13-7(12)6-11-10-5(14-6)3-4-9-8/h9H,2-4H2,1H3 |
| InChIKey | VZIAJXOEPODHBC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.63 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|