C8H14N2OS — CID 106458138
5-(2-propoxyethyl)-1,3-thiazol-2-amine (PubChem CID 106458138) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 5-(2-propoxyethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2-propoxyethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106458138 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 5-(2-propoxyethyl)-1,3-thiazol-2-amine |
| SMILES | CCCOCCc1cnc(N)s1 |
| InChI | InChI=1S/C8H14N2OS/c1-2-4-11-5-3-7-6-10-8(9)12-7/h6H,2-5H2,1H3,(H2,9,10) |
| InChIKey | DHYCUALEEIIFDO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|