C13H16N2OS — CID 79774216
5-(3-phenylpropoxymethyl)-1,3-thiazol-2-amine (PubChem CID 79774216) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 5-(3-phenylpropoxymethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(3-phenylpropoxymethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79774216 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-(3-phenylpropoxymethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(COCCCc2ccccc2)s1 |
| InChI | InChI=1S/C13H16N2OS/c14-13-15-9-12(17-13)10-16-8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9H,4,7-8,10H2,(H2,14,15) |
| InChIKey | NYBHCLZQCGOHEG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|