About benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate
benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate (PubChem CID 123299686) has the molecular formula C16H17N3O3S
and a molecular weight of 331.40 g/mol. Its IUPAC name is benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate.
Molecular Properties
| Compound Name | benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate |
| PubChem CID | 123299686 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate |
| SMILES | Nc1ncc(CCC2C(=O)NC2C(=O)OCc2ccccc2)s1 |
| InChI | InChI=1S/C16H17N3O3S/c17-16-18-8-11(23-16)6-7-12-13(19-14(12)20)15(21)22-9-10-4-2-1-3-5-10/h1-5,8,12-13H,6-7,9H2,(H2,17,18)(H,19,20) |
| InChIKey | VSUZULBODGJMAV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate?
The IUPAC name of benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate (CID 123299686) is benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate.
What is the SMILES notation for benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate?
The canonical SMILES for benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate is Nc1ncc(CCC2C(=O)NC2C(=O)OCc2ccccc2)s1.
What is the InChIKey of benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate?
The InChIKey is VSUZULBODGJMAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3S/c17-16-18-8-11(23-16)6-7-12-13(19-14(12)20)15(21)22-9-10-4-2-1-3-5-10/h1-5,8,12-13H,6-7,9H2,(H2,17,18)(H,19,20).
What are the key properties of benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate?
benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate has a molecular weight of 331.40 g/mol, XLogP of 1.52, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-4-oxoazetidine-2-carboxylate is sourced from PubChem (CID 123299686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).