C31H32N4O7 — CID 91299315
benzyl (3R)-4-oxo-3-[3-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]propyl]azetidine-2-carboxylate (PubChem CID 91299315) has the molecular formula C31H32N4O7 and a molecular weight of 572.62 g/mol. Its IUPAC name is benzyl (3R)-4-oxo-3-[3-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]propyl]azetidine-2-carboxylate.
| Compound Name | benzyl (3R)-4-oxo-3-[3-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]propyl]azetidine-2-carboxylate |
|---|---|
| PubChem CID | 91299315 |
| Molecular Formula | C31H32N4O7 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | benzyl (3R)-4-oxo-3-[3-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]propyl]azetidine-2-carboxylate |
| SMILES | NC(=NC(=O)OCc1ccccc1)N(CCC[C@H]1C(=O)NC1C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H32N4O7/c32-29(34-30(38)41-20-23-13-6-2-7-14-23)35(31(39)42-21-24-15-8-3-9-16-24)18-10-17-25-26(33-27(25)36)28(37)40-19-22-11-4-1-5-12-22/h1-9,11-16,25-26H,10,17-21H2,(H,33,36)(H2,32,34,38)/t25-,26?/m1/s1 |
| InChIKey | INJZKDLHOBRSDO-DCWQJPKNSA-N |
| XLogP | 3.91 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|