C31H31N5O7 — CID 91328307
benzyl (2S)-2-(2-diazoacetyl)-5-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]pentanoate (PubChem CID 91328307) has the molecular formula C31H31N5O7 and a molecular weight of 585.62 g/mol. Its IUPAC name is benzyl (2S)-2-(2-diazoacetyl)-5-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]pentanoate.
| Compound Name | benzyl (2S)-2-(2-diazoacetyl)-5-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]pentanoate |
|---|---|
| PubChem CID | 91328307 |
| Molecular Formula | C31H31N5O7 |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | benzyl (2S)-2-(2-diazoacetyl)-5-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]pentanoate |
| SMILES | [N-]=[N+]=CC(=O)[C@H](CCCN(C(=O)OCc1ccccc1)C(N)=NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H31N5O7/c32-29(35-30(39)42-21-24-13-6-2-7-14-24)36(31(40)43-22-25-15-8-3-9-16-25)18-10-17-26(27(37)19-34-33)28(38)41-20-23-11-4-1-5-12-23/h1-9,11-16,19,26H,10,17-18,20-22H2,(H2,32,35,39)/t26-/m0/s1 |
| InChIKey | ZDEAUTNFQREBGB-SANMLTNESA-N |
| XLogP | 4.29 |
| TPSA | 173.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|