C27H33N5O6 — CID 70048513
(2S)-2-amino-5-[[N'-[(2S)-1-(2-phenylacetyl)pyrrolidine-2-carbonyl]carbamimidoyl]-phenylmethoxycarbonylamino]pentanoic acid (PubChem CID 70048513) has the molecular formula C27H33N5O6 and a molecular weight of 523.59 g/mol. Its IUPAC name is (2S)-2-amino-5-[[N'-[(2S)-1-(2-phenylacetyl)pyrrolidine-2-carbonyl]carbamimidoyl]-phenylmethoxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[N'-[(2S)-1-(2-phenylacetyl)pyrrolidine-2-carbonyl]carbamimidoyl]-phenylmethoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 70048513 |
| Molecular Formula | C27H33N5O6 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | (2S)-2-amino-5-[[N'-[(2S)-1-(2-phenylacetyl)pyrrolidine-2-carbonyl]carbamimidoyl]-phenylmethoxycarbonylamino]pentanoic acid |
| SMILES | N/C(=N\C(=O)[C@@H]1CCCN1C(=O)Cc1ccccc1)N(CCC[C@H](N)C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H33N5O6/c28-21(25(35)36)13-7-16-32(27(37)38-18-20-11-5-2-6-12-20)26(29)30-24(34)22-14-8-15-31(22)23(33)17-19-9-3-1-4-10-19/h1-6,9-12,21-22H,7-8,13-18,28H2,(H,35,36)(H2,29,30,34)/t21-,22-/m0/s1 |
| InChIKey | WOYZHAGCXGUXFQ-VXKWHMMOSA-N |
| XLogP | 1.89 |
| TPSA | 168.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|