C19H24N4O6 — CID 173345337
benzyl N-[2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]-N-(2-oxoethyl)carbamate (PubChem CID 173345337) has the molecular formula C19H24N4O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is benzyl N-[2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]-N-(2-oxoethyl)carbamate.
| Compound Name | benzyl N-[2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]-N-(2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 173345337 |
| Molecular Formula | C19H24N4O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | benzyl N-[2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]-N-(2-oxoethyl)carbamate |
| SMILES | NCC(=O)N1CCC[C@H]1C(=O)NCC(=O)N(CC=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H24N4O6/c20-11-16(25)22-8-4-7-15(22)18(27)21-12-17(26)23(9-10-24)19(28)29-13-14-5-2-1-3-6-14/h1-3,5-6,10,15H,4,7-9,11-13,20H2,(H,21,27)/t15-/m0/s1 |
| InChIKey | MXVQRMAJLJMHAR-HNNXBMFYSA-N |
| XLogP | -0.58 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|