C40H50ClN5O5 — CID 21023760
benzyl N-[3-[1-[2-amino-3-(4-chlorophenyl)propanoyl]-4-cyclohexylpiperidin-4-yl]propyl]-N-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]carbamate (PubChem CID 21023760) has the molecular formula C40H50ClN5O5 and a molecular weight of 716.32 g/mol. Its IUPAC name is benzyl N-[3-[1-[2-amino-3-(4-chlorophenyl)propanoyl]-4-cyclohexylpiperidin-4-yl]propyl]-N-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | benzyl N-[3-[1-[2-amino-3-(4-chlorophenyl)propanoyl]-4-cyclohexylpiperidin-4-yl]propyl]-N-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 21023760 |
| Molecular Formula | C40H50ClN5O5 |
| Molecular Weight | 716.32 g/mol |
| Exact Mass | 715.35 |
| IUPAC Name | benzyl N-[3-[1-[2-amino-3-(4-chlorophenyl)propanoyl]-4-cyclohexylpiperidin-4-yl]propyl]-N-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]carbamate |
| SMILES | N/C(=N/C(=O)OCc1ccccc1)N(CCCC1(C2CCCCC2)CCN(C(=O)C(N)Cc2ccc(Cl)cc2)CC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C40H50ClN5O5/c41-34-19-17-30(18-20-34)27-35(42)36(47)45-25-22-40(23-26-45,33-15-8-3-9-16-33)21-10-24-46(39(49)51-29-32-13-6-2-7-14-32)37(43)44-38(48)50-28-31-11-4-1-5-12-31/h1-2,4-7,11-14,17-20,33,35H,3,8-10,15-16,21-29,42H2,(H2,43,44,48) |
| InChIKey | LVSVIFFCNADBIK-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.32 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|