C24H31N3O5 — CID 11080710
benzyl N-(7-hydroxyheptyl)-N-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]carbamate (PubChem CID 11080710) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is benzyl N-(7-hydroxyheptyl)-N-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | benzyl N-(7-hydroxyheptyl)-N-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 11080710 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | benzyl N-(7-hydroxyheptyl)-N-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]carbamate |
| SMILES | N/C(=N\C(=O)OCc1ccccc1)N(CCCCCCCO)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H31N3O5/c25-22(26-23(29)31-18-20-12-6-4-7-13-20)27(16-10-2-1-3-11-17-28)24(30)32-19-21-14-8-5-9-15-21/h4-9,12-15,28H,1-3,10-11,16-19H2,(H2,25,26,29) |
| InChIKey | SXRMPPMZCZBLGZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|