C28H36N4O8 — CID 11146096
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[phenylmethoxycarbonyl-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]amino]hexanoic acid (PubChem CID 11146096) has the molecular formula C28H36N4O8 and a molecular weight of 556.62 g/mol. Its IUPAC name is (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[phenylmethoxycarbonyl-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]amino]hexanoic acid.
| Compound Name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[phenylmethoxycarbonyl-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 11146096 |
| Molecular Formula | C28H36N4O8 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[phenylmethoxycarbonyl-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]amino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN(C(=O)OCc1ccccc1)/C(N)=N/C(=O)OCc1ccccc1)CC(=O)O |
| InChI | InChI=1S/C28H36N4O8/c1-28(2,3)40-26(36)30-22(17-23(33)34)15-10-16-32(27(37)39-19-21-13-8-5-9-14-21)24(29)31-25(35)38-18-20-11-6-4-7-12-20/h4-9,11-14,22H,10,15-19H2,1-3H3,(H,30,36)(H,33,34)(H2,29,31,35)/t22-/m0/s1 |
| InChIKey | GELXHAVBNVBICJ-QFIPXVFZSA-N |
| XLogP | 4.42 |
| TPSA | 169.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|