C32H32N4O6 — CID 86738840
naphthalen-1-yl (2S)-2-amino-5-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]pentanoate (PubChem CID 86738840) has the molecular formula C32H32N4O6 and a molecular weight of 568.63 g/mol. Its IUPAC name is naphthalen-1-yl (2S)-2-amino-5-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]pentanoate.
| Compound Name | naphthalen-1-yl (2S)-2-amino-5-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]pentanoate |
|---|---|
| PubChem CID | 86738840 |
| Molecular Formula | C32H32N4O6 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | naphthalen-1-yl (2S)-2-amino-5-[phenylmethoxycarbonyl-(N'-phenylmethoxycarbonylcarbamimidoyl)amino]pentanoate |
| SMILES | NC(=NC(=O)OCc1ccccc1)N(CCC[C@H](N)C(=O)Oc1cccc2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H32N4O6/c33-27(29(37)42-28-19-9-16-25-15-7-8-17-26(25)28)18-10-20-36(32(39)41-22-24-13-5-2-6-14-24)30(34)35-31(38)40-21-23-11-3-1-4-12-23/h1-9,11-17,19,27H,10,18,20-22,33H2,(H2,34,35,38)/t27-/m0/s1 |
| InChIKey | SKRPPNCBIIKKRS-MHZLTWQESA-N |
| XLogP | 5.14 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|