C32H31N5O5 — CID 70230536
benzyl N-[4-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-N-(N'-phenylmethoxycarbonylcarbamimidoyl)carbamate (PubChem CID 70230536) has the molecular formula C32H31N5O5 and a molecular weight of 565.63 g/mol. Its IUPAC name is benzyl N-[4-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-N-(N'-phenylmethoxycarbonylcarbamimidoyl)carbamate.
| Compound Name | benzyl N-[4-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-N-(N'-phenylmethoxycarbonylcarbamimidoyl)carbamate |
|---|---|
| PubChem CID | 70230536 |
| Molecular Formula | C32H31N5O5 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | benzyl N-[4-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-N-(N'-phenylmethoxycarbonylcarbamimidoyl)carbamate |
| SMILES | NC(=NC(=O)OCc1ccccc1)N(C(=O)OCc1ccccc1)c1ccc(NC(=O)[C@@H](N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H31N5O5/c33-28(20-23-10-4-1-5-11-23)29(38)35-26-16-18-27(19-17-26)37(32(40)42-22-25-14-8-3-9-15-25)30(34)36-31(39)41-21-24-12-6-2-7-13-24/h1-19,28H,20-22,33H2,(H,35,38)(H2,34,36,39)/t28-/m0/s1 |
| InChIKey | ZKBFTLDNDJWXRO-NDEPHWFRSA-N |
| XLogP | 4.99 |
| TPSA | 149.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|