C35H34N4O8 — CID 22995852
methyl 2-(phenylmethoxycarbonylamino)-3-[3-[phenylmethoxycarbonyl-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]amino]phenyl]propanoate (PubChem CID 22995852) has the molecular formula C35H34N4O8 and a molecular weight of 638.68 g/mol. Its IUPAC name is methyl 2-(phenylmethoxycarbonylamino)-3-[3-[phenylmethoxycarbonyl-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]amino]phenyl]propanoate.
| Compound Name | methyl 2-(phenylmethoxycarbonylamino)-3-[3-[phenylmethoxycarbonyl-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 22995852 |
| Molecular Formula | C35H34N4O8 |
| Molecular Weight | 638.68 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | methyl 2-(phenylmethoxycarbonylamino)-3-[3-[phenylmethoxycarbonyl-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]amino]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1cccc(N(C(=O)OCc2ccccc2)/C(N)=N\C(=O)OCc2ccccc2)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H34N4O8/c1-44-31(40)30(37-33(41)45-22-25-12-5-2-6-13-25)21-28-18-11-19-29(20-28)39(35(43)47-24-27-16-9-4-10-17-27)32(36)38-34(42)46-23-26-14-7-3-8-15-26/h2-20,30H,21-24H2,1H3,(H,37,41)(H2,36,38,42) |
| InChIKey | WUHTUNUUUPLALZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 158.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|