C23H21ClN2O4 — CID 132537455
methyl 3-[3-(6-chloro-3-pyridinyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 132537455) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is methyl 3-[3-(6-chloro-3-pyridinyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | methyl 3-[3-(6-chloro-3-pyridinyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 132537455 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | methyl 3-[3-(6-chloro-3-pyridinyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COC(=O)C(Cc1cccc(-c2ccc(Cl)nc2)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H21ClN2O4/c1-29-22(27)20(26-23(28)30-15-16-6-3-2-4-7-16)13-17-8-5-9-18(12-17)19-10-11-21(24)25-14-19/h2-12,14,20H,13,15H2,1H3,(H,26,28) |
| InChIKey | YNPIFFYSYJCZQX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|