C20H26N2O3 — CID 145446038
ethane;ethyl 4-[[(2S)-2-amino-3-phenylpropanoyl]amino]benzoate (PubChem CID 145446038) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is ethane;ethyl 4-[[(2S)-2-amino-3-phenylpropanoyl]amino]benzoate.
| Compound Name | ethane;ethyl 4-[[(2S)-2-amino-3-phenylpropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 145446038 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | ethane;ethyl 4-[[(2S)-2-amino-3-phenylpropanoyl]amino]benzoate |
| SMILES | CC.CCOC(=O)c1ccc(NC(=O)[C@@H](N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20N2O3.C2H6/c1-2-23-18(22)14-8-10-15(11-9-14)20-17(21)16(19)12-13-6-4-3-5-7-13;1-2/h3-11,16H,2,12,19H2,1H3,(H,20,21);1-2H3/t16-;/m0./s1 |
| InChIKey | FYAJHKXZNMKTDF-NTISSMGPSA-N |
| XLogP | 3.40 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |