C20H24NO7P — CID 57174211
ethyl 4-[(2-dimethoxyphosphoryloxy-3-phenylpropanoyl)amino]benzoate (PubChem CID 57174211) has the molecular formula C20H24NO7P and a molecular weight of 421.39 g/mol. Its IUPAC name is ethyl 4-[(2-dimethoxyphosphoryloxy-3-phenylpropanoyl)amino]benzoate.
| Compound Name | ethyl 4-[(2-dimethoxyphosphoryloxy-3-phenylpropanoyl)amino]benzoate |
|---|---|
| PubChem CID | 57174211 |
| Molecular Formula | C20H24NO7P |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | ethyl 4-[(2-dimethoxyphosphoryloxy-3-phenylpropanoyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(Cc2ccccc2)OP(=O)(OC)OC)cc1 |
| InChI | InChI=1S/C20H24NO7P/c1-4-27-20(23)16-10-12-17(13-11-16)21-19(22)18(28-29(24,25-2)26-3)14-15-8-6-5-7-9-15/h5-13,18H,4,14H2,1-3H3,(H,21,22) |
| InChIKey | AZQURSPVFNWTRB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|