C24H24NO6P — CID 18633815
4-[[(2S)-2-[hydroxy(2-phenylethyl)phosphoryl]oxy-3-phenylpropanoyl]amino]benzoic acid (PubChem CID 18633815) has the molecular formula C24H24NO6P and a molecular weight of 453.43 g/mol. Its IUPAC name is 4-[[(2S)-2-[hydroxy(2-phenylethyl)phosphoryl]oxy-3-phenylpropanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-2-[hydroxy(2-phenylethyl)phosphoryl]oxy-3-phenylpropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18633815 |
| Molecular Formula | C24H24NO6P |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 4-[[(2S)-2-[hydroxy(2-phenylethyl)phosphoryl]oxy-3-phenylpropanoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)[C@H](Cc2ccccc2)OP(=O)(O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24NO6P/c26-23(25-21-13-11-20(12-14-21)24(27)28)22(17-19-9-5-2-6-10-19)31-32(29,30)16-15-18-7-3-1-4-8-18/h1-14,22H,15-17H2,(H,25,26)(H,27,28)(H,29,30)/t22-/m0/s1 |
| InChIKey | XALCHCDPCJITGJ-QFIPXVFZSA-N |
| XLogP | 4.38 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|