C22H31N3O3SSi — CID 140683989
benzyl (2S,3R)-3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidine-2-carboxylate (PubChem CID 140683989) has the molecular formula C22H31N3O3SSi and a molecular weight of 445.66 g/mol. Its IUPAC name is benzyl (2S,3R)-3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidine-2-carboxylate.
| Compound Name | benzyl (2S,3R)-3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 140683989 |
| Molecular Formula | C22H31N3O3SSi |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | benzyl (2S,3R)-3-[2-(2-amino-1,3-thiazol-5-yl)ethyl]-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidine-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)[C@H](CCc2cnc(N)s2)[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H31N3O3SSi/c1-22(2,3)30(4,5)25-18(20(27)28-14-15-9-7-6-8-10-15)17(19(25)26)12-11-16-13-24-21(23)29-16/h6-10,13,17-18H,11-12,14H2,1-5H3,(H2,23,24)/t17-,18+/m1/s1 |
| InChIKey | LBRKHOXQJZXTDB-MSOLQXFVSA-N |
| XLogP | 4.23 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|