C24H38BrNO4Si — CID 15392000
benzyl (2S)-4-bromo-2-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]-2-(2-methylpropyl)-4-oxoazetidin-3-yl]oxybutanoate (PubChem CID 15392000) has the molecular formula C24H38BrNO4Si and a molecular weight of 512.56 g/mol. Its IUPAC name is benzyl (2S)-4-bromo-2-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]-2-(2-methylpropyl)-4-oxoazetidin-3-yl]oxybutanoate.
| Compound Name | benzyl (2S)-4-bromo-2-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]-2-(2-methylpropyl)-4-oxoazetidin-3-yl]oxybutanoate |
|---|---|
| PubChem CID | 15392000 |
| Molecular Formula | C24H38BrNO4Si |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | benzyl (2S)-4-bromo-2-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]-2-(2-methylpropyl)-4-oxoazetidin-3-yl]oxybutanoate |
| SMILES | CC(C)C[C@H]1[C@H](O[C@@H](CCBr)C(=O)OCc2ccccc2)C(=O)N1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H38BrNO4Si/c1-17(2)15-19-21(22(27)26(19)31(6,7)24(3,4)5)30-20(13-14-25)23(28)29-16-18-11-9-8-10-12-18/h8-12,17,19-21H,13-16H2,1-7H3/t19-,20-,21-/m0/s1 |
| InChIKey | PHKSJPQOOJDLNG-ACRUOGEOSA-N |
| XLogP | 5.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|