C22H30N2O5Si — CID 70018383
benzyl (1S,4Z,5R)-6-[tert-butyl(dimethyl)silyl]-4-(2-methoxy-2-oxoethylidene)-7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70018383) has the molecular formula C22H30N2O5Si and a molecular weight of 430.58 g/mol. Its IUPAC name is benzyl (1S,4Z,5R)-6-[tert-butyl(dimethyl)silyl]-4-(2-methoxy-2-oxoethylidene)-7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (1S,4Z,5R)-6-[tert-butyl(dimethyl)silyl]-4-(2-methoxy-2-oxoethylidene)-7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70018383 |
| Molecular Formula | C22H30N2O5Si |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | benzyl (1S,4Z,5R)-6-[tert-butyl(dimethyl)silyl]-4-(2-methoxy-2-oxoethylidene)-7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)/C=C1/CN(C(=O)OCc2ccccc2)[C@@H]2C(=O)N([Si](C)(C)C(C)(C)C)[C@H]12 |
| InChI | InChI=1S/C22H30N2O5Si/c1-22(2,3)30(5,6)24-18-16(12-17(25)28-4)13-23(19(18)20(24)26)21(27)29-14-15-10-8-7-9-11-15/h7-12,18-19H,13-14H2,1-6H3/b16-12-/t18-,19+/m1/s1 |
| InChIKey | BQUZUXUBPFMOHC-IMZBMNNASA-N |
| XLogP | 3.32 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|