C35H37NO8 — CID 135019148
dibenzyl (2S,3S,4Z)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-3-(2-oxo-2-phenylmethoxyethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 135019148) has the molecular formula C35H37NO8 and a molecular weight of 599.68 g/mol. Its IUPAC name is dibenzyl (2S,3S,4Z)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-3-(2-oxo-2-phenylmethoxyethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | dibenzyl (2S,3S,4Z)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-3-(2-oxo-2-phenylmethoxyethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 135019148 |
| Molecular Formula | C35H37NO8 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | dibenzyl (2S,3S,4Z)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-3-(2-oxo-2-phenylmethoxyethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)/C=C1\CN(C(=O)OCc2ccccc2)[C@H](C(=O)OCc2ccccc2)[C@H]1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H37NO8/c1-35(2,3)44-31(38)19-28-21-36(34(40)43-24-27-17-11-6-12-18-27)32(33(39)42-23-26-15-9-5-10-16-26)29(28)20-30(37)41-22-25-13-7-4-8-14-25/h4-19,29,32H,20-24H2,1-3H3/b28-19+/t29-,32-/m0/s1 |
| InChIKey | QLDDSTWGSYLNOX-LZDFVICDSA-N |
| XLogP | 5.77 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|