C20H29NO3Si — CID 70489460
benzyl (E)-4-[(2R)-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-2-yl]but-2-enoate (PubChem CID 70489460) has the molecular formula C20H29NO3Si and a molecular weight of 359.54 g/mol. Its IUPAC name is benzyl (E)-4-[(2R)-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-2-yl]but-2-enoate.
| Compound Name | benzyl (E)-4-[(2R)-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 70489460 |
| Molecular Formula | C20H29NO3Si |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | benzyl (E)-4-[(2R)-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-2-yl]but-2-enoate |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)C[C@H]1C/C=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H29NO3Si/c1-20(2,3)25(4,5)21-17(14-18(21)22)12-9-13-19(23)24-15-16-10-7-6-8-11-16/h6-11,13,17H,12,14-15H2,1-5H3/b13-9+/t17-/m1/s1 |
| InChIKey | HZSIYEKSTBCSIM-JZUUQJBKSA-N |
| XLogP | 4.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|