C20H31NO4Si — CID 12804719
benzyl 4-[1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-2-yl]-3-hydroxybutanoate (PubChem CID 12804719) has the molecular formula C20H31NO4Si and a molecular weight of 377.56 g/mol. Its IUPAC name is benzyl 4-[1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-2-yl]-3-hydroxybutanoate.
| Compound Name | benzyl 4-[1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-2-yl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 12804719 |
| Molecular Formula | C20H31NO4Si |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | benzyl 4-[1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-2-yl]-3-hydroxybutanoate |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)CC1CC(O)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H31NO4Si/c1-20(2,3)26(4,5)21-16(12-18(21)23)11-17(22)13-19(24)25-14-15-9-7-6-8-10-15/h6-10,16-17,22H,11-14H2,1-5H3 |
| InChIKey | XOFNCAPZHFQTCP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|