C21H29NO4Si — CID 174178750
cyclohexa-1,3-dien-5-yn-1-ylmethyl (2S,3R)-1-[tert-butyl(dimethyl)silyl]-4-oxo-3-(4-oxobutyl)azetidine-2-carboxylate (PubChem CID 174178750) has the molecular formula C21H29NO4Si and a molecular weight of 387.55 g/mol. Its IUPAC name is cyclohexa-1,3-dien-5-yn-1-ylmethyl (2S,3R)-1-[tert-butyl(dimethyl)silyl]-4-oxo-3-(4-oxobutyl)azetidine-2-carboxylate.
| Compound Name | cyclohexa-1,3-dien-5-yn-1-ylmethyl (2S,3R)-1-[tert-butyl(dimethyl)silyl]-4-oxo-3-(4-oxobutyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 174178750 |
| Molecular Formula | C21H29NO4Si |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | cyclohexa-1,3-dien-5-yn-1-ylmethyl (2S,3R)-1-[tert-butyl(dimethyl)silyl]-4-oxo-3-(4-oxobutyl)azetidine-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)[C@H](CCCC=O)[C@H]1C(=O)OCc1c#cccc1 |
| InChI | InChI=1S/C21H29NO4Si/c1-21(2,3)27(4,5)22-18(17(19(22)24)13-9-10-14-23)20(25)26-15-16-11-7-6-8-12-16/h6-7,11,14,17-18H,9-10,13,15H2,1-5H3/t17-,18+/m1/s1 |
| InChIKey | LFXOKZJBZGBKQT-MSOLQXFVSA-N |
| XLogP | 3.53 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|