C36H44N4O5Si — CID 54107307
phenyl N-[N'-[4-[(3R,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(2-phenylethenyl)azetidin-3-yl]butyl]-N-phenoxycarbonylcarbamimidoyl]carbamate (PubChem CID 54107307) has the molecular formula C36H44N4O5Si and a molecular weight of 640.86 g/mol. Its IUPAC name is phenyl N-[N'-[4-[(3R,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(2-phenylethenyl)azetidin-3-yl]butyl]-N-phenoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | phenyl N-[N'-[4-[(3R,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(2-phenylethenyl)azetidin-3-yl]butyl]-N-phenoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 54107307 |
| Molecular Formula | C36H44N4O5Si |
| Molecular Weight | 640.86 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | phenyl N-[N'-[4-[(3R,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-(2-phenylethenyl)azetidin-3-yl]butyl]-N-phenoxycarbonylcarbamimidoyl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)[C@H](CCCCN=C(NC(=O)Oc2ccccc2)NC(=O)Oc2ccccc2)[C@H]1C=Cc1ccccc1 |
| InChI | InChI=1S/C36H44N4O5Si/c1-36(2,3)46(4,5)40-31(25-24-27-17-9-6-10-18-27)30(32(40)41)23-15-16-26-37-33(38-34(42)44-28-19-11-7-12-20-28)39-35(43)45-29-21-13-8-14-22-29/h6-14,17-22,24-25,30-31H,15-16,23,26H2,1-5H3,(H2,37,38,39,42,43)/t30-,31-/m1/s1 |
| InChIKey | NEQULAAEYQRWSO-FIRIVFDPSA-N |
| XLogP | 7.64 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.86 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|