C25H21NO3 — CID 54273586
phenyl 3-benzyl-2-oxo-4-(2-phenylethenyl)azetidine-1-carboxylate (PubChem CID 54273586) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is phenyl 3-benzyl-2-oxo-4-(2-phenylethenyl)azetidine-1-carboxylate.
| Compound Name | phenyl 3-benzyl-2-oxo-4-(2-phenylethenyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 54273586 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | phenyl 3-benzyl-2-oxo-4-(2-phenylethenyl)azetidine-1-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1C(=O)C(Cc2ccccc2)C1C=Cc1ccccc1 |
| InChI | InChI=1S/C25H21NO3/c27-24-22(18-20-12-6-2-7-13-20)23(17-16-19-10-4-1-5-11-19)26(24)25(28)29-21-14-8-3-9-15-21/h1-17,22-23H,18H2 |
| InChIKey | RLVURFROHVJDGX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |