C20H27NO5 — CID 70177342
tert-butyl (3R,4S)-3-(1-ethoxyethoxy)-2-oxo-4-[(E)-2-phenylethenyl]azetidine-1-carboxylate (PubChem CID 70177342) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-(1-ethoxyethoxy)-2-oxo-4-[(E)-2-phenylethenyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-(1-ethoxyethoxy)-2-oxo-4-[(E)-2-phenylethenyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 70177342 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | tert-butyl (3R,4S)-3-(1-ethoxyethoxy)-2-oxo-4-[(E)-2-phenylethenyl]azetidine-1-carboxylate |
| SMILES | CCOC(C)O[C@H]1C(=O)N(C(=O)OC(C)(C)C)[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H27NO5/c1-6-24-14(2)25-17-16(13-12-15-10-8-7-9-11-15)21(18(17)22)19(23)26-20(3,4)5/h7-14,16-17H,6H2,1-5H3/b13-12+/t14?,16-,17+/m0/s1 |
| InChIKey | WBVQQBOHJVFBFQ-MZPAUZOBSA-N |
| XLogP | 3.61 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|