C25H28N2O3 — CID 101025937
tert-butyl (2S,5Z)-5-benzylidene-6-oxo-3-phenyl-2-propan-2-yl-2H-pyrazine-1-carboxylate (PubChem CID 101025937) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is tert-butyl (2S,5Z)-5-benzylidene-6-oxo-3-phenyl-2-propan-2-yl-2H-pyrazine-1-carboxylate.
| Compound Name | tert-butyl (2S,5Z)-5-benzylidene-6-oxo-3-phenyl-2-propan-2-yl-2H-pyrazine-1-carboxylate |
|---|---|
| PubChem CID | 101025937 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | tert-butyl (2S,5Z)-5-benzylidene-6-oxo-3-phenyl-2-propan-2-yl-2H-pyrazine-1-carboxylate |
| SMILES | CC(C)[C@H]1C(c2ccccc2)=N/C(=C\c2ccccc2)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H28N2O3/c1-17(2)22-21(19-14-10-7-11-15-19)26-20(16-18-12-8-6-9-13-18)23(28)27(22)24(29)30-25(3,4)5/h6-17,22H,1-5H3/b20-16-/t22-/m0/s1 |
| InChIKey | ULNSOCXVHOAEBL-YEMUAQJGSA-N |
| XLogP | 5.32 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|