C32H37NO4Si — CID 53254258
tert-butyl (3S,4R)-3-[tert-butyl(diphenyl)silyl]oxy-2-oxo-4-[(E)-2-phenylethenyl]azetidine-1-carboxylate (PubChem CID 53254258) has the molecular formula C32H37NO4Si and a molecular weight of 527.74 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-[tert-butyl(diphenyl)silyl]oxy-2-oxo-4-[(E)-2-phenylethenyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-[tert-butyl(diphenyl)silyl]oxy-2-oxo-4-[(E)-2-phenylethenyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 53254258 |
| Molecular Formula | C32H37NO4Si |
| Molecular Weight | 527.74 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | tert-butyl (3S,4R)-3-[tert-butyl(diphenyl)silyl]oxy-2-oxo-4-[(E)-2-phenylethenyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C32H37NO4Si/c1-31(2,3)36-30(35)33-27(23-22-24-16-10-7-11-17-24)28(29(33)34)37-38(32(4,5)6,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h7-23,27-28H,1-6H3/b23-22+/t27-,28+/m1/s1 |
| InChIKey | HCNADEHYNPBKIZ-VFZFTLRCSA-N |
| XLogP | 5.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.74 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|