C21H31NO3 — CID 70052022
tert-butyl 4-[1-[(Z)-3-phenylprop-2-enoxy]ethyl]piperidine-1-carboxylate (PubChem CID 70052022) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is tert-butyl 4-[1-[(Z)-3-phenylprop-2-enoxy]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[(Z)-3-phenylprop-2-enoxy]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70052022 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | tert-butyl 4-[1-[(Z)-3-phenylprop-2-enoxy]ethyl]piperidine-1-carboxylate |
| SMILES | CC(OC/C=C\c1ccccc1)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H31NO3/c1-17(24-16-8-11-18-9-6-5-7-10-18)19-12-14-22(15-13-19)20(23)25-21(2,3)4/h5-11,17,19H,12-16H2,1-4H3/b11-8- |
| InChIKey | REOLFEYBNGLMPR-FLIBITNWSA-N |
| XLogP | 4.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |