C18H25NO3Se — CID 139266573
tert-butyl 4-[(1S)-2-oxo-1-phenylselanylethyl]piperidine-1-carboxylate (PubChem CID 139266573) has the molecular formula C18H25NO3Se and a molecular weight of 382.36 g/mol. Its IUPAC name is tert-butyl 4-[(1S)-2-oxo-1-phenylselanylethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1S)-2-oxo-1-phenylselanylethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139266573 |
| Molecular Formula | C18H25NO3Se |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | tert-butyl 4-[(1S)-2-oxo-1-phenylselanylethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC([C@@H](C=O)[Se]c2ccccc2)CC1 |
| InChI | InChI=1S/C18H25NO3Se/c1-18(2,3)22-17(21)19-11-9-14(10-12-19)16(13-20)23-15-7-5-4-6-8-15/h4-8,13-14,16H,9-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | IVASLJGPDRKDPB-MRXNPFEDSA-N |
| XLogP | 2.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|