C15H22O3 — CID 87487130
1,1-diethoxyethane;(Z)-3-phenylprop-2-enal (PubChem CID 87487130) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1,1-diethoxyethane;(Z)-3-phenylprop-2-enal.
| Compound Name | 1,1-diethoxyethane;(Z)-3-phenylprop-2-enal |
|---|---|
| PubChem CID | 87487130 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1,1-diethoxyethane;(Z)-3-phenylprop-2-enal |
| SMILES | CCOC(C)OCC.O=C/C=C\c1ccccc1 |
| InChI | InChI=1S/C9H8O.C6H14O2/c10-8-4-7-9-5-2-1-3-6-9;1-4-7-6(3)8-5-2/h1-8H;6H,4-5H2,1-3H3/b7-4-; |
| InChIKey | AGWABWIGXKAPIE-ZULQGGHCSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|