C13H16Cl4O — CID 174831174
1,1-dichloroethane;1,2-dichloroethane;(E)-3-phenylprop-2-enal (PubChem CID 174831174) has the molecular formula C13H16Cl4O and a molecular weight of 330.08 g/mol. Its IUPAC name is 1,1-dichloroethane;1,2-dichloroethane;(E)-3-phenylprop-2-enal.
| Compound Name | 1,1-dichloroethane;1,2-dichloroethane;(E)-3-phenylprop-2-enal |
|---|---|
| PubChem CID | 174831174 |
| Molecular Formula | C13H16Cl4O |
| Molecular Weight | 330.08 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 1,1-dichloroethane;1,2-dichloroethane;(E)-3-phenylprop-2-enal |
| SMILES | CC(Cl)Cl.ClCCCl.O=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C9H8O.2C2H4Cl2/c10-8-4-7-9-5-2-1-3-6-9;1-2(3)4;3-1-2-4/h1-8H;2H,1H3;1-2H2/b7-4+;; |
| InChIKey | OCRWVUVTGSKZSC-RDRKJGRWSA-N |
| XLogP | 5.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.08 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|