About 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal
2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal (PubChem CID 146635918) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal.
Molecular Properties
| Compound Name | 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal |
| PubChem CID | 146635918 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal |
| SMILES | COC(C=O)OC.O=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C9H8O.C4H8O3/c10-8-4-7-9-5-2-1-3-6-9;1-6-4(3-5)7-2/h1-8H;3-4H,1-2H3/b7-4+; |
| InChIKey | OYAZRBCNRCAZGR-KQGICBIGSA-N |
| XLogP | 1.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal?
The IUPAC name of 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal (CID 146635918) is 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal.
What is the SMILES notation for 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal?
The canonical SMILES for 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal is COC(C=O)OC.O=C/C=C/c1ccccc1.
What is the InChIKey of 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal?
The InChIKey is OYAZRBCNRCAZGR-KQGICBIGSA-N. The full InChI is InChI=1S/C9H8O.C4H8O3/c10-8-4-7-9-5-2-1-3-6-9;1-6-4(3-5)7-2/h1-8H;3-4H,1-2H3/b7-4+;.
What are the key properties of 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal?
2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal has a molecular weight of 236.27 g/mol, XLogP of 1.70, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxyacetaldehyde;(E)-3-phenylprop-2-enal is sourced from PubChem (CID 146635918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).